C26H29NO5 — CID 155172205
tert-butyl 2-[3-[3-(1-hydroxyethyl)-1-oxoisochromen-4-yl]phenyl]pyrrolidine-1-carboxylate (PubChem CID 155172205) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is tert-butyl 2-[3-[3-(1-hydroxyethyl)-1-oxoisochromen-4-yl]phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-[3-(1-hydroxyethyl)-1-oxoisochromen-4-yl]phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155172205 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | tert-butyl 2-[3-[3-(1-hydroxyethyl)-1-oxoisochromen-4-yl]phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(O)c1oc(=O)c2ccccc2c1-c1cccc(C2CCCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H29NO5/c1-16(28)23-22(19-11-5-6-12-20(19)24(29)31-23)18-10-7-9-17(15-18)21-13-8-14-27(21)25(30)32-26(2,3)4/h5-7,9-12,15-16,21,28H,8,13-14H2,1-4H3 |
| InChIKey | BQROZGLHHPHOSN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |