C11H14N2O — CID 155183611
8-amino-5-(methylamino)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 155183611) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 8-amino-5-(methylamino)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 8-amino-5-(methylamino)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 155183611 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 8-amino-5-(methylamino)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CNc1ccc(N)c2c1CCCC2=O |
| InChI | InChI=1S/C11H14N2O/c1-13-9-6-5-8(12)11-7(9)3-2-4-10(11)14/h5-6,13H,2-4,12H2,1H3 |
| InChIKey | LETOKKRYDFZTMK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|