C34H32F2N4O6S — CID 155184758
1-N'-[3-fluoro-4-[6-methoxy-7-[3-[(2-oxothiolan-3-yl)amino]propoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 155184758) has the molecular formula C34H32F2N4O6S and a molecular weight of 662.72 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[6-methoxy-7-[3-[(2-oxothiolan-3-yl)amino]propoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[6-methoxy-7-[3-[(2-oxothiolan-3-yl)amino]propoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 155184758 |
| Molecular Formula | C34H32F2N4O6S |
| Molecular Weight | 662.72 g/mol |
| Exact Mass | 662.20 |
| IUPAC Name | 1-N'-[3-fluoro-4-[6-methoxy-7-[3-[(2-oxothiolan-3-yl)amino]propoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)ccnc2cc1OCCCNC1CCSC1=O |
| InChI | InChI=1S/C34H32F2N4O6S/c1-44-29-18-23-26(19-30(29)45-15-2-13-37-25-10-16-47-31(25)41)38-14-9-27(23)46-28-8-7-22(17-24(28)36)40-33(43)34(11-12-34)32(42)39-21-5-3-20(35)4-6-21/h3-9,14,17-19,25,37H,2,10-13,15-16H2,1H3,(H,39,42)(H,40,43) |
| InChIKey | IPNZPFPDFXGFRR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.72 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|