C17H38N2OS2 — CID 155205046
4-[4-(disulfanylamino)-2,4-dimethylpentan-2-yl]oxy-2,4-dimethyl-N-propan-2-ylpentan-2-amine (PubChem CID 155205046) has the molecular formula C17H38N2OS2 and a molecular weight of 350.64 g/mol. Its IUPAC name is 4-[4-(disulfanylamino)-2,4-dimethylpentan-2-yl]oxy-2,4-dimethyl-N-propan-2-ylpentan-2-amine.
| Compound Name | 4-[4-(disulfanylamino)-2,4-dimethylpentan-2-yl]oxy-2,4-dimethyl-N-propan-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 155205046 |
| Molecular Formula | C17H38N2OS2 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 4-[4-(disulfanylamino)-2,4-dimethylpentan-2-yl]oxy-2,4-dimethyl-N-propan-2-ylpentan-2-amine |
| SMILES | CC(C)NC(C)(C)CC(C)(C)OC(C)(C)CC(C)(C)NSS |
| InChI | InChI=1S/C17H38N2OS2/c1-13(2)18-14(3,4)11-16(7,8)20-17(9,10)12-15(5,6)19-22-21/h13,18-19,21H,11-12H2,1-10H3 |
| InChIKey | BTWPWZQJHYMNFS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|