C12H13F3N2O2S2 — CID 155231045
N-(cyclopropylmethoxy)-1-[2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-thiazol-5-yl]methanimine (PubChem CID 155231045) has the molecular formula C12H13F3N2O2S2 and a molecular weight of 338.38 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-1-[2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-thiazol-5-yl]methanimine.
| Compound Name | N-(cyclopropylmethoxy)-1-[2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-thiazol-5-yl]methanimine |
|---|---|
| PubChem CID | 155231045 |
| Molecular Formula | C12H13F3N2O2S2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N-(cyclopropylmethoxy)-1-[2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-thiazol-5-yl]methanimine |
| SMILES | O=S(CCC(F)=C(F)F)c1ncc(C=NOCC2CC2)s1 |
| InChI | InChI=1S/C12H13F3N2O2S2/c13-10(11(14)15)3-4-21(18)12-16-5-9(20-12)6-17-19-7-8-1-2-8/h5-6,8H,1-4,7H2 |
| InChIKey | DVELLZDLQHCXRF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|