About 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline
2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline (PubChem CID 155249617) has the molecular formula C13H23N3
and a molecular weight of 221.35 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline |
| PubChem CID | 155249617 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cc(N)c(N(C)N)c(C(C)C)c1 |
| InChI | InChI=1S/C13H23N3/c1-8(2)10-6-11(9(3)4)13(16(5)15)12(14)7-10/h6-9H,14-15H2,1-5H3 |
| InChIKey | QCJZVGVJIKGDBD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline?
The IUPAC name of 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline (CID 155249617) is 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline.
What is the SMILES notation for 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline?
The canonical SMILES for 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline is CC(C)c1cc(N)c(N(C)N)c(C(C)C)c1.
What is the InChIKey of 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline?
The InChIKey is QCJZVGVJIKGDBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3/c1-8(2)10-6-11(9(3)4)13(16(5)15)12(14)7-10/h6-9H,14-15H2,1-5H3.
What are the key properties of 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline?
2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline has a molecular weight of 221.35 g/mol, XLogP of 2.83, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino(methyl)amino]-3,5-di(propan-2-yl)aniline is sourced from PubChem (CID 155249617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).