C20H21F3N2O3S — CID 155278897
[3,5-dimethyl-4-[(3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl)methyl]phenyl] trifluoromethanesulfonate (PubChem CID 155278897) has the molecular formula C20H21F3N2O3S and a molecular weight of 426.46 g/mol. Its IUPAC name is [3,5-dimethyl-4-[(3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl)methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dimethyl-4-[(3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl)methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155278897 |
| Molecular Formula | C20H21F3N2O3S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [3,5-dimethyl-4-[(3-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl)methyl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)cc(C)c1Cc1ccc2[nH]cc(C(C)C)c2n1 |
| InChI | InChI=1S/C20H21F3N2O3S/c1-11(2)17-10-24-18-6-5-14(25-19(17)18)9-16-12(3)7-15(8-13(16)4)28-29(26,27)20(21,22)23/h5-8,10-11,24H,9H2,1-4H3 |
| InChIKey | MJXCUGQLFBYKMW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|