C42H76O2 — CID 155294478
(4E,8E,11E,21E,28E)-2,31-dimethoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-4,8,11,21,28-pentaene (PubChem CID 155294478) has the molecular formula C42H76O2 and a molecular weight of 613.07 g/mol. Its IUPAC name is (4E,8E,11E,21E,28E)-2,31-dimethoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-4,8,11,21,28-pentaene.
| Compound Name | (4E,8E,11E,21E,28E)-2,31-dimethoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-4,8,11,21,28-pentaene |
|---|---|
| PubChem CID | 155294478 |
| Molecular Formula | C42H76O2 |
| Molecular Weight | 613.07 g/mol |
| Exact Mass | 612.58 |
| IUPAC Name | (4E,8E,11E,21E,28E)-2,31-dimethoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-4,8,11,21,28-pentaene |
| SMILES | COC(C)(C)C/C=C/C(C)C/C=C/C(C)/C=C/CC(C)CCCCC(C)C/C=C/C(C)CCCC(C)/C=C/CC(C)(C)OC |
| InChI | InChI=1S/C42H76O2/c1-35(23-15-25-37(3)27-17-29-39(5)31-19-33-41(7,8)43-11)21-13-14-22-36(2)24-16-26-38(4)28-18-30-40(6)32-20-34-42(9,10)44-12/h15-17,19-20,25-27,31-32,35-40H,13-14,18,21-24,28-30,33-34H2,1-12H3/b25-15+,26-16+,27-17+,31-19+,32-20+ |
| InChIKey | GUUPJCLENSZPFZ-RLNKGMIASA-N |
| XLogP | 13.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.07 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|