C13H13N3O6S — CID 155294772
4-(2-hydroxy-4-nitrophenyl)-2,2-dioxo-1,3,4,6,7,8-hexahydro-2λ6,1,3-benzothiadiazin-5-one (PubChem CID 155294772) has the molecular formula C13H13N3O6S and a molecular weight of 339.33 g/mol. Its IUPAC name is 4-(2-hydroxy-4-nitrophenyl)-2,2-dioxo-1,3,4,6,7,8-hexahydro-2λ6,1,3-benzothiadiazin-5-one.
| Compound Name | 4-(2-hydroxy-4-nitrophenyl)-2,2-dioxo-1,3,4,6,7,8-hexahydro-2λ6,1,3-benzothiadiazin-5-one |
|---|---|
| PubChem CID | 155294772 |
| Molecular Formula | C13H13N3O6S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 4-(2-hydroxy-4-nitrophenyl)-2,2-dioxo-1,3,4,6,7,8-hexahydro-2λ6,1,3-benzothiadiazin-5-one |
| SMILES | O=C1CCCC2=C1C(c1ccc([N+](=O)[O-])cc1O)NS(=O)(=O)N2 |
| InChI | InChI=1S/C13H13N3O6S/c17-10-3-1-2-9-12(10)13(15-23(21,22)14-9)8-5-4-7(16(19)20)6-11(8)18/h4-6,13-15,18H,1-3H2 |
| InChIKey | ZCXGCJUOIZYTPB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|