C13H13ClN2O3S — CID 155294739
4-(2-chlorophenyl)-2,2-dioxo-1,3,4,6,7,8-hexahydro-2λ6,1,3-benzothiadiazin-5-one (PubChem CID 155294739) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-2,2-dioxo-1,3,4,6,7,8-hexahydro-2λ6,1,3-benzothiadiazin-5-one.
| Compound Name | 4-(2-chlorophenyl)-2,2-dioxo-1,3,4,6,7,8-hexahydro-2λ6,1,3-benzothiadiazin-5-one |
|---|---|
| PubChem CID | 155294739 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 4-(2-chlorophenyl)-2,2-dioxo-1,3,4,6,7,8-hexahydro-2λ6,1,3-benzothiadiazin-5-one |
| SMILES | O=C1CCCC2=C1C(c1ccccc1Cl)NS(=O)(=O)N2 |
| InChI | InChI=1S/C13H13ClN2O3S/c14-9-5-2-1-4-8(9)13-12-10(6-3-7-11(12)17)15-20(18,19)16-13/h1-2,4-5,13,15-16H,3,6-7H2 |
| InChIKey | NSKCLCMGFWGWLJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |