C21H21Cl2N3O6 — CID 155311428
[4-chloro-2-(2,2-dimethoxyethyl)phenyl]-[(2S,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methanone (PubChem CID 155311428) has the molecular formula C21H21Cl2N3O6 and a molecular weight of 482.32 g/mol. Its IUPAC name is [4-chloro-2-(2,2-dimethoxyethyl)phenyl]-[(2S,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methanone.
| Compound Name | [4-chloro-2-(2,2-dimethoxyethyl)phenyl]-[(2S,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methanone |
|---|---|
| PubChem CID | 155311428 |
| Molecular Formula | C21H21Cl2N3O6 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | [4-chloro-2-(2,2-dimethoxyethyl)phenyl]-[(2S,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methanone |
| SMILES | COC(Cc1cc(Cl)ccc1C(=O)[C@H]1O[C@@H](n2ccc3c(Cl)ncnc32)[C@H](O)[C@@H]1O)OC |
| InChI | InChI=1S/C21H21Cl2N3O6/c1-30-14(31-2)8-10-7-11(22)3-4-12(10)15(27)18-16(28)17(29)21(32-18)26-6-5-13-19(23)24-9-25-20(13)26/h3-7,9,14,16-18,21,28-29H,8H2,1-2H3/t16-,17+,18+,21+/m0/s1 |
| InChIKey | YGMVUKQRTCYEFG-XKGFGPFHSA-N |
| XLogP | 2.40 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|