C17H26N2O — CID 155329557
3-ethyl-1-(7-methylimidazo[1,5-a]pyridin-8-yl)heptan-1-ol (PubChem CID 155329557) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 3-ethyl-1-(7-methylimidazo[1,5-a]pyridin-8-yl)heptan-1-ol.
| Compound Name | 3-ethyl-1-(7-methylimidazo[1,5-a]pyridin-8-yl)heptan-1-ol |
|---|---|
| PubChem CID | 155329557 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 3-ethyl-1-(7-methylimidazo[1,5-a]pyridin-8-yl)heptan-1-ol |
| SMILES | CCCCC(CC)CC(O)c1c(C)ccn2cncc12 |
| InChI | InChI=1S/C17H26N2O/c1-4-6-7-14(5-2)10-16(20)17-13(3)8-9-19-12-18-11-15(17)19/h8-9,11-12,14,16,20H,4-7,10H2,1-3H3 |
| InChIKey | XLABEQXRPZWUFA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |