C22H31N3O3 — CID 155330232
N-butan-2-yl-2-formyl-7-methoxy-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide (PubChem CID 155330232) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-butan-2-yl-2-formyl-7-methoxy-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide.
| Compound Name | N-butan-2-yl-2-formyl-7-methoxy-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 155330232 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-butan-2-yl-2-formyl-7-methoxy-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
| SMILES | CCC(C)NC(=O)C1Cc2c([nH]c3cc(OC)ccc23)C(CC(C)C)N1C=O |
| InChI | InChI=1S/C22H31N3O3/c1-6-14(4)23-22(27)20-11-17-16-8-7-15(28-5)10-18(16)24-21(17)19(9-13(2)3)25(20)12-26/h7-8,10,12-14,19-20,24H,6,9,11H2,1-5H3,(H,23,27) |
| InChIKey | RXEPXFXJISHJCG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|