C22H32N2O2 — CID 177142016
6-methoxy-17-methyl-15-(2-methylbutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraen-14-ol (PubChem CID 177142016) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 6-methoxy-17-methyl-15-(2-methylbutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraen-14-ol.
| Compound Name | 6-methoxy-17-methyl-15-(2-methylbutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraen-14-ol |
|---|---|
| PubChem CID | 177142016 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 6-methoxy-17-methyl-15-(2-methylbutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraen-14-ol |
| SMILES | CCC(C)CC1CC2c3[nH]c4cc(OC)ccc4c3CCN(C2C)C1O |
| InChI | InChI=1S/C22H32N2O2/c1-5-13(2)10-15-11-19-14(3)24(22(15)25)9-8-18-17-7-6-16(26-4)12-20(17)23-21(18)19/h6-7,12-15,19,22-23,25H,5,8-11H2,1-4H3 |
| InChIKey | LCQIPGDNTKNJFB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |