C26H27N — CID 155369899
2,2,4-trimethyl-6-[2-(naphthalen-1-ylmethyl)prop-2-enyl]-1H-quinoline (PubChem CID 155369899) has the molecular formula C26H27N and a molecular weight of 353.51 g/mol. Its IUPAC name is 2,2,4-trimethyl-6-[2-(naphthalen-1-ylmethyl)prop-2-enyl]-1H-quinoline.
| Compound Name | 2,2,4-trimethyl-6-[2-(naphthalen-1-ylmethyl)prop-2-enyl]-1H-quinoline |
|---|---|
| PubChem CID | 155369899 |
| Molecular Formula | C26H27N |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 2,2,4-trimethyl-6-[2-(naphthalen-1-ylmethyl)prop-2-enyl]-1H-quinoline |
| SMILES | C=C(Cc1ccc2c(c1)C(C)=CC(C)(C)N2)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C26H27N/c1-18(15-22-10-7-9-21-8-5-6-11-23(21)22)14-20-12-13-25-24(16-20)19(2)17-26(3,4)27-25/h5-13,16-17,27H,1,14-15H2,2-4H3 |
| InChIKey | HUUHBECIMMFPFP-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|