C27H28N2O3 — CID 155394290
3-[4-methyl-2-[5-(2-pyrrolidin-1-ylethoxy)-2-pyridinyl]-2H-chromen-3-yl]phenol (PubChem CID 155394290) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 3-[4-methyl-2-[5-(2-pyrrolidin-1-ylethoxy)-2-pyridinyl]-2H-chromen-3-yl]phenol.
| Compound Name | 3-[4-methyl-2-[5-(2-pyrrolidin-1-ylethoxy)-2-pyridinyl]-2H-chromen-3-yl]phenol |
|---|---|
| PubChem CID | 155394290 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 3-[4-methyl-2-[5-(2-pyrrolidin-1-ylethoxy)-2-pyridinyl]-2H-chromen-3-yl]phenol |
| SMILES | CC1=C(c2cccc(O)c2)C(c2ccc(OCCN3CCCC3)cn2)Oc2ccccc21 |
| InChI | InChI=1S/C27H28N2O3/c1-19-23-9-2-3-10-25(23)32-27(26(19)20-7-6-8-21(30)17-20)24-12-11-22(18-28-24)31-16-15-29-13-4-5-14-29/h2-3,6-12,17-18,27,30H,4-5,13-16H2,1H3 |
| InChIKey | RQQCQAHPWWHYQM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|