C16H10ClF4N3O — CID 155412414
1-(4-chloro-3-fluoro-1H-indol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 155412414) has the molecular formula C16H10ClF4N3O and a molecular weight of 371.72 g/mol. Its IUPAC name is 1-(4-chloro-3-fluoro-1H-indol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-chloro-3-fluoro-1H-indol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 155412414 |
| Molecular Formula | C16H10ClF4N3O |
| Molecular Weight | 371.72 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 1-(4-chloro-3-fluoro-1H-indol-6-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1cc(Cl)c2c(F)c[nH]c2c1 |
| InChI | InChI=1S/C16H10ClF4N3O/c17-11-5-10(6-13-14(11)12(18)7-22-13)24-15(25)23-9-3-1-8(2-4-9)16(19,20)21/h1-7,22H,(H2,23,24,25) |
| InChIKey | NUPIRURWNDGCSM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |