C25H28ClFN2O2 — CID 155416456
(2R,6S)-N-(4-chlorophenyl)-6-(6-fluoroquinolin-4-yl)-6-hydroxy-2-methylnonanamide (PubChem CID 155416456) has the molecular formula C25H28ClFN2O2 and a molecular weight of 442.96 g/mol. Its IUPAC name is (2R,6S)-N-(4-chlorophenyl)-6-(6-fluoroquinolin-4-yl)-6-hydroxy-2-methylnonanamide.
| Compound Name | (2R,6S)-N-(4-chlorophenyl)-6-(6-fluoroquinolin-4-yl)-6-hydroxy-2-methylnonanamide |
|---|---|
| PubChem CID | 155416456 |
| Molecular Formula | C25H28ClFN2O2 |
| Molecular Weight | 442.96 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (2R,6S)-N-(4-chlorophenyl)-6-(6-fluoroquinolin-4-yl)-6-hydroxy-2-methylnonanamide |
| SMILES | CCC[C@](O)(CCC[C@@H](C)C(=O)Nc1ccc(Cl)cc1)c1ccnc2ccc(F)cc12 |
| InChI | InChI=1S/C25H28ClFN2O2/c1-3-13-25(31,22-12-15-28-23-11-8-19(27)16-21(22)23)14-4-5-17(2)24(30)29-20-9-6-18(26)7-10-20/h6-12,15-17,31H,3-5,13-14H2,1-2H3,(H,29,30)/t17-,25+/m1/s1 |
| InChIKey | XZISYJOAHNNHTQ-NSYGIPOTSA-N |
| XLogP | 6.46 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.96 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |