C9H16O2 — CID 15541689
(E)-3-methylideneoct-5-ene-1,7-diol (PubChem CID 15541689) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (E)-3-methylideneoct-5-ene-1,7-diol.
| Compound Name | (E)-3-methylideneoct-5-ene-1,7-diol |
|---|---|
| PubChem CID | 15541689 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (E)-3-methylideneoct-5-ene-1,7-diol |
| SMILES | C=C(C/C=C/C(C)O)CCO |
| InChI | InChI=1S/C9H16O2/c1-8(6-7-10)4-3-5-9(2)11/h3,5,9-11H,1,4,6-7H2,2H3/b5-3+ |
| InChIKey | DUWVHIILVLXQEP-HWKANZROSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|