C17H20N4O8 — CID 155420065
[(3R)-7-(cyclopropylcarbamoyl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate (PubChem CID 155420065) has the molecular formula C17H20N4O8 and a molecular weight of 408.37 g/mol. Its IUPAC name is [(3R)-7-(cyclopropylcarbamoyl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [(3R)-7-(cyclopropylcarbamoyl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 155420065 |
| Molecular Formula | C17H20N4O8 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [(3R)-7-(cyclopropylcarbamoyl)-9,12-dioxo-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-dien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N[C@@H]1COCC(C(=O)NC3CC3)N1C2=O |
| InChI | InChI=1S/C17H20N4O8/c1-26-17(25)29-8-28-14-11(22)4-5-20-13(14)16(24)21-10(6-27-7-12(21)19-20)15(23)18-9-2-3-9/h4-5,9-10,12,19H,2-3,6-8H2,1H3,(H,18,23)/t10?,12-/m0/s1 |
| InChIKey | ZMOZAUJTZDVQOF-KFJBMODSSA-N |
| XLogP | -1.03 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|