C21H28NO6P — CID 155429698
[2-[(4-octoxybenzoyl)amino]phenyl] dihydrogen phosphate (PubChem CID 155429698) has the molecular formula C21H28NO6P and a molecular weight of 421.43 g/mol. Its IUPAC name is [2-[(4-octoxybenzoyl)amino]phenyl] dihydrogen phosphate.
| Compound Name | [2-[(4-octoxybenzoyl)amino]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 155429698 |
| Molecular Formula | C21H28NO6P |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [2-[(4-octoxybenzoyl)amino]phenyl] dihydrogen phosphate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Nc2ccccc2OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C21H28NO6P/c1-2-3-4-5-6-9-16-27-18-14-12-17(13-15-18)21(23)22-19-10-7-8-11-20(19)28-29(24,25)26/h7-8,10-15H,2-6,9,16H2,1H3,(H,22,23)(H2,24,25,26) |
| InChIKey | QVBBDVUAHLFVKM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|