C47H83NO — CID 155439866
(8E,12Z,15Z)-1-[4-(methylamino)cyclohexyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]docosa-8,12,15-trien-1-one (PubChem CID 155439866) has the molecular formula C47H83NO and a molecular weight of 678.19 g/mol. Its IUPAC name is (8E,12Z,15Z)-1-[4-(methylamino)cyclohexyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]docosa-8,12,15-trien-1-one.
| Compound Name | (8E,12Z,15Z)-1-[4-(methylamino)cyclohexyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]docosa-8,12,15-trien-1-one |
|---|---|
| PubChem CID | 155439866 |
| Molecular Formula | C47H83NO |
| Molecular Weight | 678.19 g/mol |
| Exact Mass | 677.65 |
| IUPAC Name | (8E,12Z,15Z)-1-[4-(methylamino)cyclohexyl]-3-[(9Z,12Z)-octadeca-9,12-dienyl]docosa-8,12,15-trien-1-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCC/C=C/CC/C=C\C/C=C\CCCCCC)CC(=O)C1CCC(NC)CC1 |
| InChI | InChI=1S/C47H83NO/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-44(43-47(49)45-39-41-46(48-3)42-40-45)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h13-16,19-22,28,30,44-46,48H,4-12,17-18,23-27,29,31-43H2,1-3H3/b15-13-,16-14-,21-19-,22-20-,30-28+ |
| InChIKey | JHAXQWYVTJSZGW-SRRJIFKASA-N |
| XLogP | 14.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.19 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|