C47H87NO — CID 58559635
(12Z,15Z)-1-[3-(dimethylamino)cyclohexyl]-3-[(Z)-octadec-9-enyl]henicosa-12,15-dien-1-one (PubChem CID 58559635) has the molecular formula C47H87NO and a molecular weight of 682.22 g/mol. Its IUPAC name is (12Z,15Z)-1-[3-(dimethylamino)cyclohexyl]-3-[(Z)-octadec-9-enyl]henicosa-12,15-dien-1-one.
| Compound Name | (12Z,15Z)-1-[3-(dimethylamino)cyclohexyl]-3-[(Z)-octadec-9-enyl]henicosa-12,15-dien-1-one |
|---|---|
| PubChem CID | 58559635 |
| Molecular Formula | C47H87NO |
| Molecular Weight | 682.22 g/mol |
| Exact Mass | 681.68 |
| IUPAC Name | (12Z,15Z)-1-[3-(dimethylamino)cyclohexyl]-3-[(Z)-octadec-9-enyl]henicosa-12,15-dien-1-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\CCCCCCCC)CC(=O)C1CCCC(N(C)C)C1 |
| InChI | InChI=1S/C47H87NO/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-44(42-47(49)45-40-37-41-46(43-45)48(3)4)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13,15,19-22,44-46H,5-12,14,16-18,23-43H2,1-4H3/b15-13-,21-19-,22-20- |
| InChIKey | CMVAVTPERNICST-YVFFZHSKSA-N |
| XLogP | 15.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.22 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|