C20H28N2O2S2 — CID 155443343
[6-cyano-2,5,5-trimethyl-2-[methyl(phenyl)carbamothioyl]sulfanylhexan-3-yl] acetate (PubChem CID 155443343) has the molecular formula C20H28N2O2S2 and a molecular weight of 392.59 g/mol. Its IUPAC name is [6-cyano-2,5,5-trimethyl-2-[methyl(phenyl)carbamothioyl]sulfanylhexan-3-yl] acetate.
| Compound Name | [6-cyano-2,5,5-trimethyl-2-[methyl(phenyl)carbamothioyl]sulfanylhexan-3-yl] acetate |
|---|---|
| PubChem CID | 155443343 |
| Molecular Formula | C20H28N2O2S2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [6-cyano-2,5,5-trimethyl-2-[methyl(phenyl)carbamothioyl]sulfanylhexan-3-yl] acetate |
| SMILES | CC(=O)OC(CC(C)(C)CC#N)C(C)(C)SC(=S)N(C)c1ccccc1 |
| InChI | InChI=1S/C20H28N2O2S2/c1-15(23)24-17(14-19(2,3)12-13-21)20(4,5)26-18(25)22(6)16-10-8-7-9-11-16/h7-11,17H,12,14H2,1-6H3 |
| InChIKey | YNFRIFKKKYMRMZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|