C30H38FN7S2 — CID 155469612
N-[2-ethyl-6-[4-(3-pyrrolidin-1-ylpropylsulfanyl)piperazin-1-yl]imidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine (PubChem CID 155469612) has the molecular formula C30H38FN7S2 and a molecular weight of 579.82 g/mol. Its IUPAC name is N-[2-ethyl-6-[4-(3-pyrrolidin-1-ylpropylsulfanyl)piperazin-1-yl]imidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[2-ethyl-6-[4-(3-pyrrolidin-1-ylpropylsulfanyl)piperazin-1-yl]imidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155469612 |
| Molecular Formula | C30H38FN7S2 |
| Molecular Weight | 579.82 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | N-[2-ethyl-6-[4-(3-pyrrolidin-1-ylpropylsulfanyl)piperazin-1-yl]imidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine |
| SMILES | CCc1nc2ccc(N3CCN(SCCCN4CCCC4)CC3)cn2c1N(C)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C30H38FN7S2/c1-3-26-29(34(2)30-33-27(22-39-30)23-7-9-24(31)10-8-23)38-21-25(11-12-28(38)32-26)36-16-18-37(19-17-36)40-20-6-15-35-13-4-5-14-35/h7-12,21-22H,3-6,13-20H2,1-2H3 |
| InChIKey | CYFHUBHFLHYAOH-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 43.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.82 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|