C31H31FP2 — CID 155476394
[(Z)-3-diphenylphosphanyl-4,4-dimethylpent-2-enyl]-(2-fluorophenyl)-phenylphosphane (PubChem CID 155476394) has the molecular formula C31H31FP2 and a molecular weight of 484.54 g/mol. Its IUPAC name is [(Z)-3-diphenylphosphanyl-4,4-dimethylpent-2-enyl]-(2-fluorophenyl)-phenylphosphane.
| Compound Name | [(Z)-3-diphenylphosphanyl-4,4-dimethylpent-2-enyl]-(2-fluorophenyl)-phenylphosphane |
|---|---|
| PubChem CID | 155476394 |
| Molecular Formula | C31H31FP2 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [(Z)-3-diphenylphosphanyl-4,4-dimethylpent-2-enyl]-(2-fluorophenyl)-phenylphosphane |
| SMILES | CC(C)(C)/C(=C/CP(c1ccccc1)c1ccccc1F)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H31FP2/c1-31(2,3)30(34(26-17-9-5-10-18-26)27-19-11-6-12-20-27)23-24-33(25-15-7-4-8-16-25)29-22-14-13-21-28(29)32/h4-23H,24H2,1-3H3/b30-23- |
| InChIKey | OVOMAOVBODOECR-WMMMYUQOSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|