C19H22FP — CID 161322688
(2-fluorophenyl)-phenyl-[(E)-2,3,3-trimethylbut-1-enyl]phosphane (PubChem CID 161322688) has the molecular formula C19H22FP and a molecular weight of 300.36 g/mol. Its IUPAC name is (2-fluorophenyl)-phenyl-[(E)-2,3,3-trimethylbut-1-enyl]phosphane.
| Compound Name | (2-fluorophenyl)-phenyl-[(E)-2,3,3-trimethylbut-1-enyl]phosphane |
|---|---|
| PubChem CID | 161322688 |
| Molecular Formula | C19H22FP |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (2-fluorophenyl)-phenyl-[(E)-2,3,3-trimethylbut-1-enyl]phosphane |
| SMILES | C/C(=C\P(c1ccccc1)c1ccccc1F)C(C)(C)C |
| InChI | InChI=1S/C19H22FP/c1-15(19(2,3)4)14-21(16-10-6-5-7-11-16)18-13-9-8-12-17(18)20/h5-14H,1-4H3/b15-14+ |
| InChIKey | XXRKIWNFICBTBZ-CCEZHUSRSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|