C24H31P — CID 102241788
[(1E,3E)-2-tert-butyl-5,5-dimethylhexa-1,3-dienyl]-diphenylphosphane (PubChem CID 102241788) has the molecular formula C24H31P and a molecular weight of 350.49 g/mol. Its IUPAC name is [(1E,3E)-2-tert-butyl-5,5-dimethylhexa-1,3-dienyl]-diphenylphosphane.
| Compound Name | [(1E,3E)-2-tert-butyl-5,5-dimethylhexa-1,3-dienyl]-diphenylphosphane |
|---|---|
| PubChem CID | 102241788 |
| Molecular Formula | C24H31P |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | [(1E,3E)-2-tert-butyl-5,5-dimethylhexa-1,3-dienyl]-diphenylphosphane |
| SMILES | CC(C)(C)/C=C/C(=C\P(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H31P/c1-23(2,3)18-17-20(24(4,5)6)19-25(21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-19H,1-6H3/b18-17+,20-19+ |
| InChIKey | VAZICYCGKJEDOB-GHPQSQKNSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|