C23H22N6O2 — CID 155482596
(2Z,4E)-5-cyano-N-[3-(2-methoxy-4-pyridinyl)-1H-indazol-5-yl]-3,4-dimethyl-2-(methylideneamino)hexa-2,4-dienamide (PubChem CID 155482596) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is (2Z,4E)-5-cyano-N-[3-(2-methoxy-4-pyridinyl)-1H-indazol-5-yl]-3,4-dimethyl-2-(methylideneamino)hexa-2,4-dienamide.
| Compound Name | (2Z,4E)-5-cyano-N-[3-(2-methoxy-4-pyridinyl)-1H-indazol-5-yl]-3,4-dimethyl-2-(methylideneamino)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 155482596 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (2Z,4E)-5-cyano-N-[3-(2-methoxy-4-pyridinyl)-1H-indazol-5-yl]-3,4-dimethyl-2-(methylideneamino)hexa-2,4-dienamide |
| SMILES | C=N/C(C(=O)Nc1ccc2[nH]nc(-c3ccnc(OC)c3)c2c1)=C(C)\C(C)=C(/C)C#N |
| InChI | InChI=1S/C23H22N6O2/c1-13(12-24)14(2)15(3)21(25-4)23(30)27-17-6-7-19-18(11-17)22(29-28-19)16-8-9-26-20(10-16)31-5/h6-11H,4H2,1-3,5H3,(H,27,30)(H,28,29)/b14-13+,21-15- |
| InChIKey | VXYFFKHTYVGVBP-TWGYAANKSA-N |
| XLogP | 4.41 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|