C11H21O3P — CID 15550797
4,4,5,5-tetramethyl-2-[(E)-2-methylbut-2-enyl]-1,3,2lambda5-dioxaphospholane 2-oxide (PubChem CID 15550797) has the molecular formula C11H21O3P and a molecular weight of 232.26 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E)-2-methylbut-2-enyl]-1,3,2lambda5-dioxaphospholane 2-oxide.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E)-2-methylbut-2-enyl]-1,3,2lambda5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 15550797 |
| Molecular Formula | C11H21O3P |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-2-methylbut-2-enyl]-1,3,2lambda5-dioxaphospholane 2-oxide |
| SMILES | C/C=C(\C)CP1(=O)OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H21O3P/c1-7-9(2)8-15(12)13-10(3,4)11(5,6)14-15/h7H,8H2,1-6H3/b9-7+ |
| InChIKey | OHBKRANYRDSQIX-VQHVLOKHSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|