C22H42N10O5 — CID 155518037
(2S)-1-[(2S)-4-amino-2-[[(2S)-2-amino-6-[[(2S)-2-amino-5-(diaminomethylideneamino)pentyl]carbamoylamino]hexanoyl]amino]butanoyl]-2,5-dihydropyrrole-2-carboxylic acid (PubChem CID 155518037) has the molecular formula C22H42N10O5 and a molecular weight of 526.64 g/mol. Its IUPAC name is (2S)-1-[(2S)-4-amino-2-[[(2S)-2-amino-6-[[(2S)-2-amino-5-(diaminomethylideneamino)pentyl]carbamoylamino]hexanoyl]amino]butanoyl]-2,5-dihydropyrrole-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-4-amino-2-[[(2S)-2-amino-6-[[(2S)-2-amino-5-(diaminomethylideneamino)pentyl]carbamoylamino]hexanoyl]amino]butanoyl]-2,5-dihydropyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 155518037 |
| Molecular Formula | C22H42N10O5 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | (2S)-1-[(2S)-4-amino-2-[[(2S)-2-amino-6-[[(2S)-2-amino-5-(diaminomethylideneamino)pentyl]carbamoylamino]hexanoyl]amino]butanoyl]-2,5-dihydropyrrole-2-carboxylic acid |
| SMILES | NCC[C@H](NC(=O)[C@@H](N)CCCCNC(=O)NC[C@@H](N)CCCN=C(N)N)C(=O)N1CC=C[C@H]1C(=O)O |
| InChI | InChI=1S/C22H42N10O5/c23-9-8-16(19(34)32-12-4-7-17(32)20(35)36)31-18(33)15(25)6-1-2-10-29-22(37)30-13-14(24)5-3-11-28-21(26)27/h4,7,14-17H,1-3,5-6,8-13,23-25H2,(H,31,33)(H,35,36)(H4,26,27,28)(H2,29,30,37)/t14-,15-,16-,17-/m0/s1 |
| InChIKey | DWDXIPMOWZWQOI-QAETUUGQSA-N |
| XLogP | -3.15 |
| TPSA | 270.30 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|