C17H39N11O3 — CID 87921200
1-[5-amino-6-(2-aminoethylcarbamoylamino)hexyl]-3-[2-(carbamoylamino)-5-(diaminomethylideneamino)pentyl]urea (PubChem CID 87921200) has the molecular formula C17H39N11O3 and a molecular weight of 445.57 g/mol. Its IUPAC name is 1-[5-amino-6-(2-aminoethylcarbamoylamino)hexyl]-3-[2-(carbamoylamino)-5-(diaminomethylideneamino)pentyl]urea.
| Compound Name | 1-[5-amino-6-(2-aminoethylcarbamoylamino)hexyl]-3-[2-(carbamoylamino)-5-(diaminomethylideneamino)pentyl]urea |
|---|---|
| PubChem CID | 87921200 |
| Molecular Formula | C17H39N11O3 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | 1-[5-amino-6-(2-aminoethylcarbamoylamino)hexyl]-3-[2-(carbamoylamino)-5-(diaminomethylideneamino)pentyl]urea |
| SMILES | NCCNC(=O)NCC(N)CCCCNC(=O)NCC(CCCN=C(N)N)NC(N)=O |
| InChI | InChI=1S/C17H39N11O3/c18-6-9-25-17(31)26-10-12(19)4-1-2-7-24-16(30)27-11-13(28-15(22)29)5-3-8-23-14(20)21/h12-13H,1-11,18-19H2,(H4,20,21,23)(H3,22,28,29)(H2,24,27,30)(H2,25,26,31) |
| InChIKey | GMVJFTHYQYUCKX-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 253.82 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|