C17H39N13O3 — CID 142056383
1-[1-amino-5-(diaminomethylideneamino)pentan-2-yl]-3-[2-[[2-(carbamoylamino)-5-(diaminomethylideneamino)pentyl]carbamoylamino]ethyl]urea (PubChem CID 142056383) has the molecular formula C17H39N13O3 and a molecular weight of 473.59 g/mol. Its IUPAC name is 1-[1-amino-5-(diaminomethylideneamino)pentan-2-yl]-3-[2-[[2-(carbamoylamino)-5-(diaminomethylideneamino)pentyl]carbamoylamino]ethyl]urea.
| Compound Name | 1-[1-amino-5-(diaminomethylideneamino)pentan-2-yl]-3-[2-[[2-(carbamoylamino)-5-(diaminomethylideneamino)pentyl]carbamoylamino]ethyl]urea |
|---|---|
| PubChem CID | 142056383 |
| Molecular Formula | C17H39N13O3 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | 1-[1-amino-5-(diaminomethylideneamino)pentan-2-yl]-3-[2-[[2-(carbamoylamino)-5-(diaminomethylideneamino)pentyl]carbamoylamino]ethyl]urea |
| SMILES | NCC(CCCN=C(N)N)NC(=O)NCCNC(=O)NCC(CCCN=C(N)N)NC(N)=O |
| InChI | InChI=1S/C17H39N13O3/c18-9-11(3-1-5-24-13(19)20)30-17(33)27-8-7-26-16(32)28-10-12(29-15(23)31)4-2-6-25-14(21)22/h11-12H,1-10,18H2,(H4,19,20,24)(H4,21,22,25)(H3,23,29,31)(H2,26,28,32)(H2,27,30,33) |
| InChIKey | WDGPPDSDDWNQTO-UHFFFAOYSA-N |
| XLogP | -3.94 |
| TPSA | 292.20 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|