C27H54N10O4 — CID 160503344
1-[(4S,9R)-10-(carbamoylamino)-1-(diaminomethylideneamino)-9-methyl-7-oxodecan-4-yl]-3-[(2R,7S)-10-(diaminomethylideneamino)-2,7-dimethyl-4-oxodecyl]urea (PubChem CID 160503344) has the molecular formula C27H54N10O4 and a molecular weight of 582.80 g/mol. Its IUPAC name is 1-[(4S,9R)-10-(carbamoylamino)-1-(diaminomethylideneamino)-9-methyl-7-oxodecan-4-yl]-3-[(2R,7S)-10-(diaminomethylideneamino)-2,7-dimethyl-4-oxodecyl]urea.
| Compound Name | 1-[(4S,9R)-10-(carbamoylamino)-1-(diaminomethylideneamino)-9-methyl-7-oxodecan-4-yl]-3-[(2R,7S)-10-(diaminomethylideneamino)-2,7-dimethyl-4-oxodecyl]urea |
|---|---|
| PubChem CID | 160503344 |
| Molecular Formula | C27H54N10O4 |
| Molecular Weight | 582.80 g/mol |
| Exact Mass | 582.43 |
| IUPAC Name | 1-[(4S,9R)-10-(carbamoylamino)-1-(diaminomethylideneamino)-9-methyl-7-oxodecan-4-yl]-3-[(2R,7S)-10-(diaminomethylideneamino)-2,7-dimethyl-4-oxodecyl]urea |
| SMILES | C[C@@H](CCCN=C(N)N)CCC(=O)C[C@@H](C)CNC(=O)N[C@@H](CCCN=C(N)N)CCC(=O)C[C@@H](C)CNC(N)=O |
| InChI | InChI=1S/C27H54N10O4/c1-18(6-4-12-33-24(28)29)8-10-22(38)15-20(3)17-36-27(41)37-21(7-5-13-34-25(30)31)9-11-23(39)14-19(2)16-35-26(32)40/h18-21H,4-17H2,1-3H3,(H4,28,29,33)(H4,30,31,34)(H3,32,35,40)(H2,36,37,41)/t18-,19+,20+,21-/m0/s1 |
| InChIKey | XLLUOIJNMFAMGY-BQJUDKOJSA-N |
| XLogP | 0.82 |
| TPSA | 259.19 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.80 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|