C23H22FN7O4 — CID 155523062
2-[3-[6-(5-fluoro-6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxypropylamino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 155523062) has the molecular formula C23H22FN7O4 and a molecular weight of 479.47 g/mol. Its IUPAC name is 2-[3-[6-(5-fluoro-6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxypropylamino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[3-[6-(5-fluoro-6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxypropylamino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155523062 |
| Molecular Formula | C23H22FN7O4 |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 2-[3-[6-(5-fluoro-6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxypropylamino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | COc1ncc(-c2cc(OCCCNc3ncc(C(=O)NO)cn3)c3ncnc(C)c3c2)cc1F |
| InChI | InChI=1S/C23H22FN7O4/c1-13-17-6-14(15-7-18(24)22(34-2)26-9-15)8-19(20(17)30-12-29-13)35-5-3-4-25-23-27-10-16(11-28-23)21(32)31-33/h6-12,33H,3-5H2,1-2H3,(H,31,32)(H,25,27,28) |
| InChIKey | UGRBZFIRSKXWCF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|