C22H19F3N4O5S — CID 155531203
3-[[[4-[[2-amino-4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylamino]methyl]benzoic acid (PubChem CID 155531203) has the molecular formula C22H19F3N4O5S and a molecular weight of 508.48 g/mol. Its IUPAC name is 3-[[[4-[[2-amino-4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylamino]methyl]benzoic acid.
| Compound Name | 3-[[[4-[[2-amino-4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 155531203 |
| Molecular Formula | C22H19F3N4O5S |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 3-[[[4-[[2-amino-4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylamino]methyl]benzoic acid |
| SMILES | Nc1cc(C(F)(F)F)ccc1NC(=O)Nc1ccc(S(=O)(=O)NCc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C22H19F3N4O5S/c23-22(24,25)15-4-9-19(18(26)11-15)29-21(32)28-16-5-7-17(8-6-16)35(33,34)27-12-13-2-1-3-14(10-13)20(30)31/h1-11,27H,12,26H2,(H,30,31)(H2,28,29,32) |
| InChIKey | JTEDHMCAGAFOCW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|