C30H24F3N3O8S — CID 155556833
2-[3-[2-[3-[4-[[2-amino-4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonyloxyphenyl]acetyl]oxyphenyl]acetic acid (PubChem CID 155556833) has the molecular formula C30H24F3N3O8S and a molecular weight of 643.60 g/mol. Its IUPAC name is 2-[3-[2-[3-[4-[[2-amino-4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonyloxyphenyl]acetyl]oxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-[3-[4-[[2-amino-4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonyloxyphenyl]acetyl]oxyphenyl]acetic acid |
|---|---|
| PubChem CID | 155556833 |
| Molecular Formula | C30H24F3N3O8S |
| Molecular Weight | 643.60 g/mol |
| Exact Mass | 643.12 |
| IUPAC Name | 2-[3-[2-[3-[4-[[2-amino-4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonyloxyphenyl]acetyl]oxyphenyl]acetic acid |
| SMILES | Nc1cc(C(F)(F)F)ccc1NC(=O)Nc1ccc(S(=O)(=O)Oc2cccc(CC(=O)Oc3cccc(CC(=O)O)c3)c2)cc1 |
| InChI | InChI=1S/C30H24F3N3O8S/c31-30(32,33)20-7-12-26(25(34)17-20)36-29(40)35-21-8-10-24(11-9-21)45(41,42)44-23-6-2-4-19(14-23)16-28(39)43-22-5-1-3-18(13-22)15-27(37)38/h1-14,17H,15-16,34H2,(H,37,38)(H2,35,36,40) |
| InChIKey | VUDDWKQGYZRKCB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 174.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|