C22H23N5O4 — CID 155540375
2-[[4-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-2,6-dioxopyrimidin-1-yl]methyl]-4-cyanobenzoic acid (PubChem CID 155540375) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 2-[[4-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-2,6-dioxopyrimidin-1-yl]methyl]-4-cyanobenzoic acid.
| Compound Name | 2-[[4-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-2,6-dioxopyrimidin-1-yl]methyl]-4-cyanobenzoic acid |
|---|---|
| PubChem CID | 155540375 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[[4-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-2,6-dioxopyrimidin-1-yl]methyl]-4-cyanobenzoic acid |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)cc(=O)n(Cc2cc(C#N)ccc2C(=O)O)c1=O |
| InChI | InChI=1S/C22H23N5O4/c1-2-3-9-26-19(25-8-4-5-17(24)14-25)11-20(28)27(22(26)31)13-16-10-15(12-23)6-7-18(16)21(29)30/h6-7,10-11,17H,4-5,8-9,13-14,24H2,1H3,(H,29,30)/t17-/m1/s1 |
| InChIKey | BXJCLYZXPDLVFN-QGZVFWFLSA-N |
| XLogP | 0.58 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|