C18H22N4O2S — CID 172561821
6-[(3R)-3-aminopiperidin-1-yl]-1-but-2-ynyl-3-(thiophen-3-ylmethyl)pyrimidine-2,4-dione (PubChem CID 172561821) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 6-[(3R)-3-aminopiperidin-1-yl]-1-but-2-ynyl-3-(thiophen-3-ylmethyl)pyrimidine-2,4-dione.
| Compound Name | 6-[(3R)-3-aminopiperidin-1-yl]-1-but-2-ynyl-3-(thiophen-3-ylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172561821 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 6-[(3R)-3-aminopiperidin-1-yl]-1-but-2-ynyl-3-(thiophen-3-ylmethyl)pyrimidine-2,4-dione |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)cc(=O)n(Cc2ccsc2)c1=O |
| InChI | InChI=1S/C18H22N4O2S/c1-2-3-8-21-16(20-7-4-5-15(19)12-20)10-17(23)22(18(21)24)11-14-6-9-25-13-14/h6,9-10,13,15H,4-5,7-8,11-12,19H2,1H3/t15-/m1/s1 |
| InChIKey | SKCJVQJPCYEPEZ-OAHLLOKOSA-N |
| XLogP | 1.07 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|