C22H25FN4O4 — CID 164618992
methyl 3-[[4-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-2,6-dioxopyrimidin-1-yl]methyl]-2-fluorobenzoate (PubChem CID 164618992) has the molecular formula C22H25FN4O4 and a molecular weight of 428.46 g/mol. Its IUPAC name is methyl 3-[[4-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-2,6-dioxopyrimidin-1-yl]methyl]-2-fluorobenzoate.
| Compound Name | methyl 3-[[4-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-2,6-dioxopyrimidin-1-yl]methyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 164618992 |
| Molecular Formula | C22H25FN4O4 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | methyl 3-[[4-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-2,6-dioxopyrimidin-1-yl]methyl]-2-fluorobenzoate |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)cc(=O)n(Cc2cccc(C(=O)OC)c2F)c1=O |
| InChI | InChI=1S/C22H25FN4O4/c1-3-4-11-26-18(25-10-6-8-16(24)14-25)12-19(28)27(22(26)30)13-15-7-5-9-17(20(15)23)21(29)31-2/h5,7,9,12,16H,6,8,10-11,13-14,24H2,1-2H3/t16-/m1/s1 |
| InChIKey | UFFQXMBSLZWFQG-MRXNPFEDSA-N |
| XLogP | 0.93 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|