C26H27N3O3S — CID 155542744
3-[5-[(4aR,8aS)-4-oxo-3-propan-2-yl-4a,5,8,8a-tetrahydrophthalazin-1-yl]-2-methoxyphenyl]-N-(thiophen-2-ylmethyl)prop-2-ynamide (PubChem CID 155542744) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 3-[5-[(4aR,8aS)-4-oxo-3-propan-2-yl-4a,5,8,8a-tetrahydrophthalazin-1-yl]-2-methoxyphenyl]-N-(thiophen-2-ylmethyl)prop-2-ynamide.
| Compound Name | 3-[5-[(4aR,8aS)-4-oxo-3-propan-2-yl-4a,5,8,8a-tetrahydrophthalazin-1-yl]-2-methoxyphenyl]-N-(thiophen-2-ylmethyl)prop-2-ynamide |
|---|---|
| PubChem CID | 155542744 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 3-[5-[(4aR,8aS)-4-oxo-3-propan-2-yl-4a,5,8,8a-tetrahydrophthalazin-1-yl]-2-methoxyphenyl]-N-(thiophen-2-ylmethyl)prop-2-ynamide |
| SMILES | COc1ccc(C2=NN(C(C)C)C(=O)[C@@H]3CC=CC[C@H]23)cc1C#CC(=O)NCc1cccs1 |
| InChI | InChI=1S/C26H27N3O3S/c1-17(2)29-26(31)22-9-5-4-8-21(22)25(28-29)19-10-12-23(32-3)18(15-19)11-13-24(30)27-16-20-7-6-14-33-20/h4-7,10,12,14-15,17,21-22H,8-9,16H2,1-3H3,(H,27,30)/t21-,22+/m0/s1 |
| InChIKey | VNKHPMYYXSARFF-FCHUYYIVSA-N |
| XLogP | 3.96 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|