C20H25N3O3 — CID 155544041
N-[[(4aR,7aS)-2,3,4,5,7,7a-hexahydrofuro[3,4-b]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)propanamide (PubChem CID 155544041) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[[(4aR,7aS)-2,3,4,5,7,7a-hexahydrofuro[3,4-b]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)propanamide.
| Compound Name | N-[[(4aR,7aS)-2,3,4,5,7,7a-hexahydrofuro[3,4-b]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)propanamide |
|---|---|
| PubChem CID | 155544041 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[[(4aR,7aS)-2,3,4,5,7,7a-hexahydrofuro[3,4-b]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)propanamide |
| SMILES | Nc1nc2ccccc2cc1CCC(=O)NC[C@@]12CCCO[C@@H]1COC2 |
| InChI | InChI=1S/C20H25N3O3/c21-19-15(10-14-4-1-2-5-16(14)23-19)6-7-18(24)22-12-20-8-3-9-26-17(20)11-25-13-20/h1-2,4-5,10,17H,3,6-9,11-13H2,(H2,21,23)(H,22,24)/t17-,20-/m1/s1 |
| InChIKey | CHBGCCTXAOMFAR-YLJYHZDGSA-N |
| XLogP | 2.06 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |