C30H26F3N5O4S — CID 155546724
2-[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-6,7-dimethoxyquinazolin-2-yl]sulfinyl-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 155546724) has the molecular formula C30H26F3N5O4S and a molecular weight of 609.63 g/mol. Its IUPAC name is 2-[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-6,7-dimethoxyquinazolin-2-yl]sulfinyl-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-6,7-dimethoxyquinazolin-2-yl]sulfinyl-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 155546724 |
| Molecular Formula | C30H26F3N5O4S |
| Molecular Weight | 609.63 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | 2-[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]-6,7-dimethoxyquinazolin-2-yl]sulfinyl-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc2nc(S(=O)CC(=O)Nc3ccc(C(F)(F)F)cc3)nc(Nc3c(C)cc(/C=C/C#N)cc3C)c2cc1OC |
| InChI | InChI=1S/C30H26F3N5O4S/c1-17-12-19(6-5-11-34)13-18(2)27(17)37-28-22-14-24(41-3)25(42-4)15-23(22)36-29(38-28)43(40)16-26(39)35-21-9-7-20(8-10-21)30(31,32)33/h5-10,12-15H,16H2,1-4H3,(H,35,39)(H,36,37,38)/b6-5+ |
| InChIKey | SMEIUPBAGGXEBI-AATRIKPKSA-N |
| XLogP | 6.31 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|