C27H19F2N5O2 — CID 155924477
4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-difluoroanilino]-6,7-dimethoxyquinolin-2-yl]amino]benzonitrile (PubChem CID 155924477) has the molecular formula C27H19F2N5O2 and a molecular weight of 483.48 g/mol. Its IUPAC name is 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-difluoroanilino]-6,7-dimethoxyquinolin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-difluoroanilino]-6,7-dimethoxyquinolin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 155924477 |
| Molecular Formula | C27H19F2N5O2 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-difluoroanilino]-6,7-dimethoxyquinolin-2-yl]amino]benzonitrile |
| SMILES | COc1cc2nc(Nc3ccc(C#N)cc3)cc(Nc3c(F)cc(/C=C/C#N)cc3F)c2cc1OC |
| InChI | InChI=1S/C27H19F2N5O2/c1-35-24-12-19-22(13-25(24)36-2)33-26(32-18-7-5-16(15-31)6-8-18)14-23(19)34-27-20(28)10-17(4-3-9-30)11-21(27)29/h3-8,10-14H,1-2H3,(H2,32,33,34)/b4-3+ |
| InChIKey | XDKKFLFCCXVUOO-ONEGZZNKSA-N |
| XLogP | 6.43 |
| TPSA | 102.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|