C28H20Cl2N6O4S — CID 155518771
N-(4-cyanophenyl)-2-[4-[2,6-dichloro-4-[(E)-2-cyanoethenyl]anilino]-6,7-dimethoxyquinazolin-2-yl]sulfinylacetamide (PubChem CID 155518771) has the molecular formula C28H20Cl2N6O4S and a molecular weight of 607.48 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[4-[2,6-dichloro-4-[(E)-2-cyanoethenyl]anilino]-6,7-dimethoxyquinazolin-2-yl]sulfinylacetamide.
| Compound Name | N-(4-cyanophenyl)-2-[4-[2,6-dichloro-4-[(E)-2-cyanoethenyl]anilino]-6,7-dimethoxyquinazolin-2-yl]sulfinylacetamide |
|---|---|
| PubChem CID | 155518771 |
| Molecular Formula | C28H20Cl2N6O4S |
| Molecular Weight | 607.48 g/mol |
| Exact Mass | 606.06 |
| IUPAC Name | N-(4-cyanophenyl)-2-[4-[2,6-dichloro-4-[(E)-2-cyanoethenyl]anilino]-6,7-dimethoxyquinazolin-2-yl]sulfinylacetamide |
| SMILES | COc1cc2nc(S(=O)CC(=O)Nc3ccc(C#N)cc3)nc(Nc3c(Cl)cc(/C=C/C#N)cc3Cl)c2cc1OC |
| InChI | InChI=1S/C28H20Cl2N6O4S/c1-39-23-12-19-22(13-24(23)40-2)34-28(41(38)15-25(37)33-18-7-5-16(14-32)6-8-18)36-27(19)35-26-20(29)10-17(4-3-9-31)11-21(26)30/h3-8,10-13H,15H2,1-2H3,(H,33,37)(H,34,35,36)/b4-3+ |
| InChIKey | NUCRJBJAPXZISN-ONEGZZNKSA-N |
| XLogP | 5.85 |
| TPSA | 150.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|