C19H10ClF2N7 — CID 85088554
4-[[6-chloro-3-[4-(2-cyanoethenyl)-2,6-difluoroanilino]-1,2,4-triazin-5-yl]amino]benzonitrile (PubChem CID 85088554) has the molecular formula C19H10ClF2N7 and a molecular weight of 409.79 g/mol. Its IUPAC name is 4-[[6-chloro-3-[4-(2-cyanoethenyl)-2,6-difluoroanilino]-1,2,4-triazin-5-yl]amino]benzonitrile.
| Compound Name | 4-[[6-chloro-3-[4-(2-cyanoethenyl)-2,6-difluoroanilino]-1,2,4-triazin-5-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 85088554 |
| Molecular Formula | C19H10ClF2N7 |
| Molecular Weight | 409.79 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 4-[[6-chloro-3-[4-(2-cyanoethenyl)-2,6-difluoroanilino]-1,2,4-triazin-5-yl]amino]benzonitrile |
| SMILES | N#CC=Cc1cc(F)c(Nc2nnc(Cl)c(Nc3ccc(C#N)cc3)n2)c(F)c1 |
| InChI | InChI=1S/C19H10ClF2N7/c20-17-18(25-13-5-3-11(10-24)4-6-13)27-19(29-28-17)26-16-14(21)8-12(2-1-7-23)9-15(16)22/h1-6,8-9H,(H2,25,26,27,29) |
| InChIKey | BYZWXEPKMGAJGK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.79 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|