About [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate
[4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate (PubChem CID 155547866) has the molecular formula C19H17N3O3
and a molecular weight of 335.36 g/mol. Its IUPAC name is [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate.
Molecular Properties
| Compound Name | [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate |
| PubChem CID | 155547866 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate |
| SMILES | NN/C=N/Cc1ccc(OC(=O)Oc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C19H17N3O3/c20-22-13-21-12-14-5-8-17(9-6-14)24-19(23)25-18-10-7-15-3-1-2-4-16(15)11-18/h1-11,13H,12,20H2,(H,21,22) |
| InChIKey | CLZUILRKJGVSGQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate?
The IUPAC name of [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate (CID 155547866) is [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate.
What is the SMILES notation for [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate?
The canonical SMILES for [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate is NN/C=N/Cc1ccc(OC(=O)Oc2ccc3ccccc3c2)cc1.
What is the InChIKey of [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate?
The InChIKey is CLZUILRKJGVSGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O3/c20-22-13-21-12-14-5-8-17(9-6-14)24-19(23)25-18-10-7-15-3-1-2-4-16(15)11-18/h1-11,13H,12,20H2,(H,21,22).
What are the key properties of [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate?
[4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate has a molecular weight of 335.36 g/mol, XLogP of 3.41, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(hydrazinylmethylideneamino)methyl]phenyl] naphthalen-2-yl carbonate is sourced from PubChem (CID 155547866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).