C25H48N4 — CID 155550528
N-(3-aminopropyl)-N'-[3-[[(2E,6Z,8Z)-3,7,11-trimethyldodeca-2,6,8,10-tetraenyl]amino]propyl]butane-1,4-diamine (PubChem CID 155550528) has the molecular formula C25H48N4 and a molecular weight of 404.70 g/mol. Its IUPAC name is N-(3-aminopropyl)-N'-[3-[[(2E,6Z,8Z)-3,7,11-trimethyldodeca-2,6,8,10-tetraenyl]amino]propyl]butane-1,4-diamine.
| Compound Name | N-(3-aminopropyl)-N'-[3-[[(2E,6Z,8Z)-3,7,11-trimethyldodeca-2,6,8,10-tetraenyl]amino]propyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 155550528 |
| Molecular Formula | C25H48N4 |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 404.39 |
| IUPAC Name | N-(3-aminopropyl)-N'-[3-[[(2E,6Z,8Z)-3,7,11-trimethyldodeca-2,6,8,10-tetraenyl]amino]propyl]butane-1,4-diamine |
| SMILES | CC(=C/C=C\C(=C/CC/C(=C/CNCCCNCCCCNCCCN)/C)\C)C |
| InChI | InChI=1S/C25H48N4/c1-23(2)11-7-12-24(3)13-8-14-25(4)15-22-29-21-10-20-28-18-6-5-17-27-19-9-16-26/h7,11-13,15,27-29H,5-6,8-10,14,16-22,26H2,1-4H3/b12-7-,24-13-,25-15+ |
| InChIKey | NMYCZCKCPCZGSP-TYTXVWQNSA-N |
| XLogP | 4.70 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | 485 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|