C27H30N2O7 — CID 155560152
[(1S,2R,4aS,5R,8aS)-1-formamido-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-nitrobenzoate (PubChem CID 155560152) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is [(1S,2R,4aS,5R,8aS)-1-formamido-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-nitrobenzoate.
| Compound Name | [(1S,2R,4aS,5R,8aS)-1-formamido-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 155560152 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | [(1S,2R,4aS,5R,8aS)-1-formamido-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-nitrobenzoate |
| SMILES | C=C1CC[C@H]2[C@@](C)(CC[C@@H](OC(=O)c3ccccc3[N+](=O)[O-])[C@@]2(C)NC=O)[C@@H]1/C=C/C1=CCOC1=O |
| InChI | InChI=1S/C27H30N2O7/c1-17-8-11-22-26(2,20(17)10-9-18-13-15-35-24(18)31)14-12-23(27(22,3)28-16-30)36-25(32)19-6-4-5-7-21(19)29(33)34/h4-7,9-10,13,16,20,22-23H,1,8,11-12,14-15H2,2-3H3,(H,28,30)/b10-9+/t20-,22+,23-,26+,27+/m1/s1 |
| InChIKey | NBHRDRUSDRHLQR-QSGCCCQJSA-N |
| XLogP | 4.05 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|