C13H12N6O — CID 155563602
4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol (PubChem CID 155563602) has the molecular formula C13H12N6O and a molecular weight of 268.28 g/mol. Its IUPAC name is 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol.
| Compound Name | 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol |
|---|---|
| PubChem CID | 155563602 |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol |
| SMILES | Nc1nc(N)c2nc(Nc3ccc(O)cc3)ccc2n1 |
| InChI | InChI=1S/C13H12N6O/c14-12-11-9(17-13(15)19-12)5-6-10(18-11)16-7-1-3-8(20)4-2-7/h1-6,20H,(H,16,18)(H4,14,15,17,19) |
| InChIKey | FZCOAJMPGOIPCG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|