About 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol
4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol (PubChem CID 155563602) has the molecular formula C13H12N6O
and a molecular weight of 268.28 g/mol. Its IUPAC name is 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol.
Molecular Properties
| Compound Name | 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol |
| PubChem CID | 155563602 |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol |
| SMILES | Nc1nc(N)c2nc(Nc3ccc(O)cc3)ccc2n1 |
| InChI | InChI=1S/C13H12N6O/c14-12-11-9(17-13(15)19-12)5-6-10(18-11)16-7-1-3-8(20)4-2-7/h1-6,20H,(H,16,18)(H4,14,15,17,19) |
| InChIKey | FZCOAJMPGOIPCG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol?
The IUPAC name of 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol (CID 155563602) is 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol.
What is the SMILES notation for 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol?
The canonical SMILES for 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol is Nc1nc(N)c2nc(Nc3ccc(O)cc3)ccc2n1.
What is the InChIKey of 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol?
The InChIKey is FZCOAJMPGOIPCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N6O/c14-12-11-9(17-13(15)19-12)5-6-10(18-11)16-7-1-3-8(20)4-2-7/h1-6,20H,(H,16,18)(H4,14,15,17,19).
What are the key properties of 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol?
4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol has a molecular weight of 268.28 g/mol, XLogP of 1.64, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-diaminopyrido[3,2-d]pyrimidin-6-yl)amino]phenol is sourced from PubChem (CID 155563602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).